CAS 7554-78-1 appears in our catalog under these names: 2-(2,4-Dichlorophenyl)-2-hydroxyacetic acid, 97%, 2-(2,4-Dichlorophenyl)-2-hydroxyacetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(2,4-dichlorophenyl)-2-hydroxyacetic acid (CAS 7554-78-1) is a chemical compound with the molecular formula C8H6Cl2O3 and a molecular weight of 221.03 g/mol. IUPAC name: 2-(2,4-dichlorophenyl)-2-hydroxyacetic acid. InChIKey: YBOCBYSVZOREGT-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O3 |
|---|---|
| Molecular weight | 221.03 g/mol |
| IUPAC name | 2-(2,4-dichlorophenyl)-2-hydroxyacetic acid |
| InChIKey | YBOCBYSVZOREGT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C(C(=O)O)O |
Computed by PubChem (NCBI)