Products 756846-59-0
CAS 756846-59-0 is the registry number for 2-(2-Chlorophenyl)-2-fluoroethan-1-amine Hydrochloride. Offered by: TRC. Available pack sizes: 1g.
2-(2-chlorophenyl)-2-fluoroethanamine;hydrochloride (CAS 756846-59-0) is a chemical compound with the molecular formula C8H10Cl2FN and a molecular weight of 210.07 g/mol. IUPAC name: 2-(2-chlorophenyl)-2-fluoroethanamine;hydrochloride. InChIKey: HNWVXJUIBCHHIO-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl2FN |
|---|---|
| Molecular weight | 210.07 g/mol |
| IUPAC name | 2-(2-chlorophenyl)-2-fluoroethanamine;hydrochloride |
| InChIKey | HNWVXJUIBCHHIO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(CN)F)Cl.Cl |
Computed by PubChem (NCBI)