Products 75894-07-4
CAS 75894-07-4 is the registry number for 2-(Benzo[b]thiophen-2-yl)acetic acid. Offered by: Chemat. Available pack sizes: 10mg, 50mg.
2-(1-benzothiophen-2-yl)acetic acid (CAS 75894-07-4) is a chemical compound with the molecular formula C10H8O2S and a molecular weight of 192.24 g/mol. IUPAC name: 2-(1-benzothiophen-2-yl)acetic acid. InChIKey: SAAWNQLNUJBOLW-UHFFFAOYSA-N.
| Molecular formula | C10H8O2S |
|---|---|
| Molecular weight | 192.24 g/mol |
| IUPAC name | 2-(1-benzothiophen-2-yl)acetic acid |
| InChIKey | SAAWNQLNUJBOLW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(S2)CC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-(1-benzothiophen-2-yl)acetic acid, 2-(Benzo[b]thiophen-2-yl)acetic acid, 1-benzothien-2-ylacetic acid, Benzo[b]thiophene-2-acetic acid, 1-Benzothiophen-2-Ylacetic Acid, 2-(Benzo[b]thiophen-2-yl)aceticacid, 2-benzothienyl acetic acid, 2-benzo[b]thienyl acetic acid, orb3022931, SAAWNQLNUJBOLW-UHFFFAOYSA-N