CAS 76129-23-2 appears in our catalog under these names: 2-(4-Phenylphenyl)aniline, 2-(4-Phenylphenyl)aniline, 95%, p-Terphenyl-2-amine, 95%, 95%. Offered by: Biosynth, AmBeed, Chemat. Available pack sizes: 100mg, 1g, 5g, 250mg.
2-(4-phenylphenyl)aniline (CAS 76129-23-2) is a chemical compound with the molecular formula C18H15N and a molecular weight of 245.3 g/mol. IUPAC name: 2-(4-phenylphenyl)aniline. InChIKey: LZCYDNMVXHWZSD-UHFFFAOYSA-N.
| Molecular formula | C18H15N |
|---|---|
| Molecular weight | 245.3 g/mol |
| IUPAC name | 2-(4-phenylphenyl)aniline |
| InChIKey | LZCYDNMVXHWZSD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=CC=C3N |
Computed by PubChem (NCBI)