CAS 76400-21-0 is the registry number for 4-(4-Chlorophenyl)-2-oxobutanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-(4-chlorophenyl)-2-oxobutanoic acid (CAS 76400-21-0) is a chemical compound with the molecular formula C10H9ClO3 and a molecular weight of 212.63 g/mol. IUPAC name: 4-(4-chlorophenyl)-2-oxobutanoic acid. InChIKey: HNZMKKXVFZVKII-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO3 |
|---|---|
| Molecular weight | 212.63 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-2-oxobutanoic acid |
| InChIKey | HNZMKKXVFZVKII-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCC(=O)C(=O)O)Cl |
Computed by PubChem (NCBI)