CAS 77156-57-1 appears in our catalog under these names: 2-Methyl-2,3-dihydro-1,4-benzodioxine-2-carbonyl chloride, 95%, 2-Methyl-2,3-dihydro-1,4-benzodioxine-2-carbonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3-methyl-2H-1,4-benzodioxine-3-carbonyl chloride (CAS 77156-57-1) is a chemical compound with the molecular formula C10H9ClO3 and a molecular weight of 212.63 g/mol. IUPAC name: 3-methyl-2H-1,4-benzodioxine-3-carbonyl chloride. InChIKey: LOWDXWQZUWBHMK-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO3 |
|---|---|
| Molecular weight | 212.63 g/mol |
| IUPAC name | 3-methyl-2H-1,4-benzodioxine-3-carbonyl chloride |
| InChIKey | LOWDXWQZUWBHMK-UHFFFAOYSA-N |
| SMILES | CC1(COC2=CC=CC=C2O1)C(=O)Cl |
Computed by PubChem (NCBI)