CAS 77542-54-2 appears in our catalog under these names: 5–Nitronaphthalene–2,3–diol, 5–Nitronaphthalene–2,3–diol, 5-Nitronaphthalene-2,3-diol 97%, 5-Nitronaphthalene-2,3-diol, 97%, 97%, 5-Nitronaphthalene-2,3-diol, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
5-nitronaphthalene-2,3-diol (CAS 77542-54-2) is a chemical compound with the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. IUPAC name: 5-nitronaphthalene-2,3-diol. InChIKey: LDYYFPIQYNIWIW-UHFFFAOYSA-N.
| Molecular formula | C10H7NO4 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | 5-nitronaphthalene-2,3-diol |
| InChIKey | LDYYFPIQYNIWIW-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=C(C=C2C(=C1)[N+](=O)[O-])O)O |
Computed by PubChem (NCBI)