Products 777917-71-2
CAS 777917-71-2 is the registry number for 2-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)-2-phenylacetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(2,5-dioxopyrrol-1-yl)-2-phenylacetic acid (CAS 777917-71-2) is a chemical compound with the molecular formula C12H9NO4 and a molecular weight of 231.20 g/mol. IUPAC name: 2-(2,5-dioxopyrrol-1-yl)-2-phenylacetic acid. InChIKey: TWVJGLZSSWZXGN-UHFFFAOYSA-N.
| Molecular formula | C12H9NO4 |
|---|---|
| Molecular weight | 231.20 g/mol |
| IUPAC name | 2-(2,5-dioxopyrrol-1-yl)-2-phenylacetic acid |
| InChIKey | TWVJGLZSSWZXGN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)O)N2C(=O)C=CC2=O |
Computed by PubChem (NCBI)