Products 778593-53-6
CAS 778593-53-6 is the registry number for 4-((4-Ethynylphenyl)ethynyl)-N,N-dimethylaniline, 95+%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
4-[2-(4-ethynylphenyl)ethynyl]-N,N-dimethylaniline (CAS 778593-53-6) is a chemical compound with the molecular formula C18H15N and a molecular weight of 245.3 g/mol. IUPAC name: 4-[2-(4-ethynylphenyl)ethynyl]-N,N-dimethylaniline. InChIKey: VULMLGBRQJQGIW-UHFFFAOYSA-N.
| Molecular formula | C18H15N |
|---|---|
| Molecular weight | 245.3 g/mol |
| IUPAC name | 4-[2-(4-ethynylphenyl)ethynyl]-N,N-dimethylaniline |
| InChIKey | VULMLGBRQJQGIW-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C#CC2=CC=C(C=C2)C#C |
Computed by PubChem (NCBI)