CAS 78831-78-4 appears in our catalog under these names: 3,5-Dibromo-4-nitrotoluene, 98%, 1,3-Dibromo-5-methyl-2-nitrobenzene, 97%. Offered by: Fluorochem, AmBeed. Available pack sizes: 1g, 25g.
1,3-dibromo-5-methyl-2-nitrobenzene (CAS 78831-78-4) is a chemical compound with the molecular formula C7H5Br2NO2 and a molecular weight of 294.93 g/mol. IUPAC name: 1,3-dibromo-5-methyl-2-nitrobenzene. InChIKey: XVVIBMJSRSEASD-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2NO2 |
|---|---|
| Molecular weight | 294.93 g/mol |
| IUPAC name | 1,3-dibromo-5-methyl-2-nitrobenzene |
| InChIKey | XVVIBMJSRSEASD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)Br)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)