Products 790-83-0
CAS 790-83-0 appears in our catalog under these names: Diphenylmethane-4,4'-dicarboxylic acid, Diphenylmethane-4,4′-dicarboxylic acid 97%, 4,4'-Methylenedibenzoic acid, 96%, 96%, Diphenylmethane-4,4'-dicarboxylic acid, 97%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 2g, 10g, 25g, 1g, 100g, 250mg.
4-[(4-carboxyphenyl)methyl]benzoic acid (CAS 790-83-0) is a chemical compound with the molecular formula C15H12O4 and a molecular weight of 256.25 g/mol. IUPAC name: 4-[(4-carboxyphenyl)methyl]benzoic acid. InChIKey: VTDMBRAUHKUOON-UHFFFAOYSA-N.
| Molecular formula | C15H12O4 |
|---|---|
| Molecular weight | 256.25 g/mol |
| IUPAC name | 4-[(4-carboxyphenyl)methyl]benzoic acid |
| InChIKey | VTDMBRAUHKUOON-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=CC=C(C=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)