CAS 792124-35-7 is the registry number for 1-{(1-(2-Chlorophenyl)ethylidene)amino}guanidine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-[(E)-1-(2-chlorophenyl)ethylideneamino]guanidine (CAS 792124-35-7) is a chemical compound with the molecular formula C9H11ClN4 and a molecular weight of 210.66 g/mol. IUPAC name: 2-[(E)-1-(2-chlorophenyl)ethylideneamino]guanidine. InChIKey: PGIJYSCKAWTFNG-AWNIVKPZSA-N.
| Molecular formula | C9H11ClN4 |
|---|---|
| Molecular weight | 210.66 g/mol |
| IUPAC name | 2-[(E)-1-(2-chlorophenyl)ethylideneamino]guanidine |
| InChIKey | PGIJYSCKAWTFNG-AWNIVKPZSA-N |
| SMILES | C/C(=N\N=C(N)N)/C1=CC=CC=C1Cl |
Computed by PubChem (NCBI)