CAS 81282-12-4 appears in our catalog under these names: Ethyl 5-(4-chlorophenyl)isoxazole-3-carboxylate, 98%, Ethyl 5-(4-chlorophenyl),isoxazole-3-carboxylate, 98%, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg.
Ethyl 5-(4-chlorophenyl)-1,2-oxazole-3-carboxylate (CAS 81282-12-4) is a chemical compound with the molecular formula C12H10ClNO3 and a molecular weight of 251.66 g/mol. IUPAC name: ethyl 5-(4-chlorophenyl)-1,2-oxazole-3-carboxylate. InChIKey: CJQWCZKLLDAKCX-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO3 |
|---|---|
| Molecular weight | 251.66 g/mol |
| IUPAC name | ethyl 5-(4-chlorophenyl)-1,2-oxazole-3-carboxylate |
| InChIKey | CJQWCZKLLDAKCX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NOC(=C1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)