CAS 82424-96-2 is the registry number for 3-(3-Chlorophenyl)-1,2-thiazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(3-chlorophenyl)-1,2-thiazole-5-carboxylic acid (CAS 82424-96-2) is a chemical compound with the molecular formula C10H6ClNO2S and a molecular weight of 239.68 g/mol. IUPAC name: 3-(3-chlorophenyl)-1,2-thiazole-5-carboxylic acid. InChIKey: NWUAHXGTLGILNN-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO2S |
|---|---|
| Molecular weight | 239.68 g/mol |
| IUPAC name | 3-(3-chlorophenyl)-1,2-thiazole-5-carboxylic acid |
| InChIKey | NWUAHXGTLGILNN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=NSC(=C2)C(=O)O |
Computed by PubChem (NCBI)