CAS 82787-84-6 appears in our catalog under these names: 6-Methyl-1-benzothiophene-3-carboxylic acid, 6-Methylbenzo(b)thiophene-3-carboxylic acid, 98%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 10g, 5g.
6-methyl-1-benzothiophene-3-carboxylic acid (CAS 82787-84-6) is a chemical compound with the molecular formula C10H8O2S and a molecular weight of 192.24 g/mol. IUPAC name: 6-methyl-1-benzothiophene-3-carboxylic acid. InChIKey: LGPZMCSOENSZPL-UHFFFAOYSA-N.
| Molecular formula | C10H8O2S |
|---|---|
| Molecular weight | 192.24 g/mol |
| IUPAC name | 6-methyl-1-benzothiophene-3-carboxylic acid |
| InChIKey | LGPZMCSOENSZPL-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=CS2)C(=O)O |
Computed by PubChem (NCBI)