CAS 832740-85-9 is the registry number for 3-(3-Methyl-2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)benzoic acid. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
3-(3-methyl-2,5-dioxopyrrol-1-yl)benzoic acid (CAS 832740-85-9) is a chemical compound with the molecular formula C12H9NO4 and a molecular weight of 231.20 g/mol. IUPAC name: 3-(3-methyl-2,5-dioxopyrrol-1-yl)benzoic acid. InChIKey: YVNAXNPXBKTCHH-UHFFFAOYSA-N.
| Molecular formula | C12H9NO4 |
|---|---|
| Molecular weight | 231.20 g/mol |
| IUPAC name | 3-(3-methyl-2,5-dioxopyrrol-1-yl)benzoic acid |
| InChIKey | YVNAXNPXBKTCHH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)N(C1=O)C2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)