Products 837369-52-5
CAS 837369-52-5 is the registry number for 2-Amino-2-(2,3-dichlorophenyl)acetonitrile. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2-amino-2-(2,3-dichlorophenyl)acetonitrile (CAS 837369-52-5) is a chemical compound with the molecular formula C8H6Cl2N2 and a molecular weight of 201.05 g/mol. IUPAC name: 2-amino-2-(2,3-dichlorophenyl)acetonitrile. InChIKey: ISPSTNYXZBXKOU-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2N2 |
|---|---|
| Molecular weight | 201.05 g/mol |
| IUPAC name | 2-amino-2-(2,3-dichlorophenyl)acetonitrile |
| InChIKey | ISPSTNYXZBXKOU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C(C#N)N |
Computed by PubChem (NCBI)