Products 83910-14-9
CAS 83910-14-9 is the registry number for 3-(9H-Pyrido[3,4-b]indol-3-yl)acrylic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg.
(E)-3-(9H-pyrido[3,4-b]indol-3-yl)prop-2-enoic acid (CAS 83910-14-9) is a chemical compound with the molecular formula C14H10N2O2 and a molecular weight of 238.24 g/mol. IUPAC name: (E)-3-(9H-pyrido[3,4-b]indol-3-yl)prop-2-enoic acid. InChIKey: IRCDBVQFANGJAX-AATRIKPKSA-N.
| Molecular formula | C14H10N2O2 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | (E)-3-(9H-pyrido[3,4-b]indol-3-yl)prop-2-enoic acid |
| InChIKey | IRCDBVQFANGJAX-AATRIKPKSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C=NC(=C3)/C=C/C(=O)O |
Computed by PubChem (NCBI)