Products 844877-56-1
CAS 844877-56-1 appears in our catalog under these names: Azacitidine Impurity 22, Azacitidine Impurity 40, 1,2,3,5-Tetra-O-acetyl-b-L-xylofuranose. Offered by: Chemat Brand, Hubei YoungXin, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1g.
[(2S,3R,4S,5R)-3,4,5-triacetyloxyoxolan-2-yl]methyl acetate (CAS 844877-56-1) is a chemical compound with the molecular formula C13H18O9 and a molecular weight of 318.28 g/mol. IUPAC name: [(2S,3R,4S,5R)-3,4,5-triacetyloxyoxolan-2-yl]methyl acetate. InChIKey: IHNHAHWGVLXCCI-RNJOBUHISA-N.
| Molecular formula | C13H18O9 |
|---|---|
| Molecular weight | 318.28 g/mol |
| IUPAC name | [(2S,3R,4S,5R)-3,4,5-triacetyloxyoxolan-2-yl]methyl acetate |
| InChIKey | IHNHAHWGVLXCCI-RNJOBUHISA-N |
| SMILES | CC(=O)OC[C@H]1[C@H]([C@@H]([C@H](O1)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)