Products 84923-70-6
CAS 84923-70-6 appears in our catalog under these names: 5-Formyl-2-methoxybenzoic acid, 98%, 5–Formyl–2–methoxybenzoic Acid, 5-Formyl-2-methoxybenzoic acid 96%, 5-Formyl-2-methoxybenzoic Acid, 96%, 96%, 2-Methoxy-5-formylbenzoic acid, 99.96%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5g, 1g, 25g, 10g, 100g, 100mg, 250mg, 10 g.
5-formyl-2-methoxybenzoic acid (CAS 84923-70-6) is a chemical compound with the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. IUPAC name: 5-formyl-2-methoxybenzoic acid. InChIKey: TTZPGMWNBQKNKX-UHFFFAOYSA-N.
| Molecular formula | C9H8O4 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 5-formyl-2-methoxybenzoic acid |
| InChIKey | TTZPGMWNBQKNKX-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C=O)C(=O)O |
Computed by PubChem (NCBI)