CAS 851814-20-5 appears in our catalog under these names: 8-Chloro-2,3-dihydro-1,4-benzodioxine-6-carboxylic acid, 95%, 95%, 8-Chloro-2,3-dihydro-1,4-benzodioxine-6-carboxylic acid, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
5-chloro-2,3-dihydro-1,4-benzodioxine-7-carboxylic acid (CAS 851814-20-5) is a chemical compound with the molecular formula C9H7ClO4 and a molecular weight of 214.60 g/mol. IUPAC name: 5-chloro-2,3-dihydro-1,4-benzodioxine-7-carboxylic acid. InChIKey: QXSSNLARLMWPIB-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO4 |
|---|---|
| Molecular weight | 214.60 g/mol |
| IUPAC name | 5-chloro-2,3-dihydro-1,4-benzodioxine-7-carboxylic acid |
| InChIKey | QXSSNLARLMWPIB-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=C(C=C2Cl)C(=O)O |
Computed by PubChem (NCBI)