CAS 852400-10-3 appears in our catalog under these names: 3-(3-Methylphenyl)-2-(thiophen-2-yl)prop-2-enoic acid, 3-(3-Methylphenyl)-2-(thiophen-2-yl)prop-2-enoic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 250mg, 2,5g, 5g.
(E)-3-(3-methylphenyl)-2-thiophen-2-ylprop-2-enoic acid (CAS 852400-10-3) is a chemical compound with the molecular formula C14H12O2S and a molecular weight of 244.31 g/mol. IUPAC name: (E)-3-(3-methylphenyl)-2-thiophen-2-ylprop-2-enoic acid. InChIKey: GYILLEGDYCMKQG-XFXZXTDPSA-N.
| Molecular formula | C14H12O2S |
|---|---|
| Molecular weight | 244.31 g/mol |
| IUPAC name | (E)-3-(3-methylphenyl)-2-thiophen-2-ylprop-2-enoic acid |
| InChIKey | GYILLEGDYCMKQG-XFXZXTDPSA-N |
| SMILES | CC1=CC(=CC=C1)/C=C(/C2=CC=CS2)\C(=O)O |
Computed by PubChem (NCBI)