Products 856176-63-1
CAS 856176-63-1 is the registry number for 2-(3-Methylthiophen-2-yl)quinoline-4-carboxylic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-(3-methylthiophen-2-yl)quinoline-4-carboxylic acid (CAS 856176-63-1) is a chemical compound with the molecular formula C15H11NO2S and a molecular weight of 269.3 g/mol. IUPAC name: 2-(3-methylthiophen-2-yl)quinoline-4-carboxylic acid. InChIKey: AOXMFHWNLRDIRQ-UHFFFAOYSA-N.
| Molecular formula | C15H11NO2S |
|---|---|
| Molecular weight | 269.3 g/mol |
| IUPAC name | 2-(3-methylthiophen-2-yl)quinoline-4-carboxylic acid |
| InChIKey | AOXMFHWNLRDIRQ-UHFFFAOYSA-N |
| SMILES | CC1=C(SC=C1)C2=NC3=CC=CC=C3C(=C2)C(=O)O |
Computed by PubChem (NCBI)