CAS 86317-36-4 appears in our catalog under these names: 2-Methyl-5-nitrophenyl isothiocyanate, 95%, 2-Methyl-5-nitrophenyl isothiocyanate, 98%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 25g.
2-isothiocyanato-1-methyl-4-nitrobenzene (CAS 86317-36-4) is a chemical compound with the molecular formula C8H6N2O2S and a molecular weight of 194.21 g/mol. IUPAC name: 2-isothiocyanato-1-methyl-4-nitrobenzene. InChIKey: IQINAWYOKXCYQO-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2S |
|---|---|
| Molecular weight | 194.21 g/mol |
| IUPAC name | 2-isothiocyanato-1-methyl-4-nitrobenzene |
| InChIKey | IQINAWYOKXCYQO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)[N+](=O)[O-])N=C=S |
Computed by PubChem (NCBI)