Products 865887-11-2
CAS 865887-11-2 appears in our catalog under these names: 6-Benzyloxy-1H-indazole-3-carboxylic acid, 6-Benzyloxy-1H-Indazole-3-Carboxylic Acid, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
6-phenylmethoxy-1H-indazole-3-carboxylic acid (CAS 865887-11-2) is a chemical compound with the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. IUPAC name: 6-phenylmethoxy-1H-indazole-3-carboxylic acid. InChIKey: JBPCEKWXGCHLSX-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O3 |
|---|---|
| Molecular weight | 268.27 g/mol |
| IUPAC name | 6-phenylmethoxy-1H-indazole-3-carboxylic acid |
| InChIKey | JBPCEKWXGCHLSX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC3=C(C=C2)C(=NN3)C(=O)O |
Computed by PubChem (NCBI)