CAS 867330-26-5 appears in our catalog under these names: 7-Bromo-5-methylbenzo(e)(1,2,4)triazin-3-amine, 98%, 7-Bromo-5-methylbenzo[e][1,2,4]triazin-3-amine, 97%, 97%, 7-Bromo-5-methylbenzo[e][1,2,4]triazin-3-amine, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
7-bromo-5-methyl-1,2,4-benzotriazin-3-amine (CAS 867330-26-5) is a chemical compound with the molecular formula C8H7BrN4 and a molecular weight of 239.07 g/mol. IUPAC name: 7-bromo-5-methyl-1,2,4-benzotriazin-3-amine. InChIKey: RGCPQJWQLGCWGM-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN4 |
|---|---|
| Molecular weight | 239.07 g/mol |
| IUPAC name | 7-bromo-5-methyl-1,2,4-benzotriazin-3-amine |
| InChIKey | RGCPQJWQLGCWGM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1N=C(N=N2)N)Br |
Computed by PubChem (NCBI)