Products 868697-72-7
CAS 868697-72-7 is the registry number for 2-((5-Aminopyridin-2-yl)oxy)benzonitrile, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-[(5-amino-2-pyridinyl)oxy]benzonitrile (CAS 868697-72-7) is a chemical compound with the molecular formula C12H9N3O and a molecular weight of 211.22 g/mol. IUPAC name: 2-[(5-amino-2-pyridinyl)oxy]benzonitrile. InChIKey: HUCIFPNCTYDVQG-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | 2-[(5-amino-2-pyridinyl)oxy]benzonitrile |
| InChIKey | HUCIFPNCTYDVQG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C#N)OC2=NC=C(C=C2)N |
Computed by PubChem (NCBI)