CAS 873450-61-4 appears in our catalog under these names: Ethyl 4,6-dichloropicolinate 98%, Ethyl 4,6-dichloropicolinate, 98%, 98%, Ethyl 4,6-dichloropicolinate, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
Ethyl 4,6-dichloropyridine-2-carboxylate (CAS 873450-61-4) is a chemical compound with the molecular formula C8H7Cl2NO2 and a molecular weight of 220.05 g/mol. IUPAC name: ethyl 4,6-dichloropyridine-2-carboxylate. InChIKey: BKDVLXYPBAYFMR-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO2 |
|---|---|
| Molecular weight | 220.05 g/mol |
| IUPAC name | ethyl 4,6-dichloropyridine-2-carboxylate |
| InChIKey | BKDVLXYPBAYFMR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)