Products 88040-88-4
CAS 88040-88-4 appears in our catalog under these names: 5-Ethyl-2-methoxybenzene-1-sulfonyl Chloride, 5–Ethyl–2–methoxybenzene–1–sulfonyl chloride, 5-Ethyl-2-methoxybenzene-1-sulfonyl chloride 98%, 5-Ethyl-2-methoxy-benzenesulfonyl chloride, 95%. Offered by: TRC, GLPBio, Ambeed, Fluorochem. Available pack sizes: 100mg, 10mg, 50mg, 250mg, 1g, 5g, 10g.
5-ethyl-2-methoxybenzenesulfonyl chloride (CAS 88040-88-4) is a chemical compound with the molecular formula C9H11ClO3S and a molecular weight of 234.70 g/mol. IUPAC name: 5-ethyl-2-methoxybenzenesulfonyl chloride. InChIKey: VHCODCZMAYFSHT-UHFFFAOYSA-N.
| Molecular formula | C9H11ClO3S |
|---|---|
| Molecular weight | 234.70 g/mol |
| IUPAC name | 5-ethyl-2-methoxybenzenesulfonyl chloride |
| InChIKey | VHCODCZMAYFSHT-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=C(C=C1)OC)S(=O)(=O)Cl |
Computed by PubChem (NCBI)