CAS 880462-20-4 appears in our catalog under these names: Triphenylamine-d15, 98 atom % D, min 98% Chemical Purity, Triphenylamine-d15, 99%. Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 100 mg, 25 mg, 10 mg, 5 mg, 50 mg.
2,3,4,5,6-pentadeuterio-N,N-bis(2,3,4,5,6-pentadeuteriophenyl)aniline (CAS 880462-20-4) is a chemical compound with the molecular formula C18H15N and a molecular weight of 260.4 g/mol. IUPAC name: 2,3,4,5,6-pentadeuterio-N,N-bis(2,3,4,5,6-pentadeuteriophenyl)aniline. InChIKey: ODHXBMXNKOYIBV-KLHTYYPYSA-N.
| Molecular formula | C18H15N |
|---|---|
| Molecular weight | 260.4 g/mol |
| IUPAC name | 2,3,4,5,6-pentadeuterio-N,N-bis(2,3,4,5,6-pentadeuteriophenyl)aniline |
| InChIKey | ODHXBMXNKOYIBV-KLHTYYPYSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])N(C2=C(C(=C(C(=C2[2H])[2H])[2H])[2H])[2H])C3=C(C(=C(C(=C3[2H])[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)