CAS 88525-51-3 appears in our catalog under these names: 7-Chloro-benzo(1,3)dioxole-5-carbaldehyde, 7-Chlorobenzo[d][1,3]dioxole-5-carbaldehyde, 97%, 97%. Offered by: Biosynth, Chemat. Available pack sizes: 1g, 0,5g, 2g, 5g, 10g, 100mg, 250mg.
7-chloro-1,3-benzodioxole-5-carbaldehyde (CAS 88525-51-3) is a chemical compound with the molecular formula C8H5ClO3 and a molecular weight of 184.57 g/mol. IUPAC name: 7-chloro-1,3-benzodioxole-5-carbaldehyde. InChIKey: SFBUWLLIFJURHG-UHFFFAOYSA-N.
| Molecular formula | C8H5ClO3 |
|---|---|
| Molecular weight | 184.57 g/mol |
| IUPAC name | 7-chloro-1,3-benzodioxole-5-carbaldehyde |
| InChIKey | SFBUWLLIFJURHG-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C(=CC(=C2)C=O)Cl |
Computed by PubChem (NCBI)