CAS 885270-82-6 is the registry number for 8-Chlorochroman-3-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
8-chloro-3,4-dihydro-2H-chromene-3-carboxylic acid (CAS 885270-82-6) is a chemical compound with the molecular formula C10H9ClO3 and a molecular weight of 212.63 g/mol. IUPAC name: 8-chloro-3,4-dihydro-2H-chromene-3-carboxylic acid. InChIKey: UDKQQZGONLQYLV-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO3 |
|---|---|
| Molecular weight | 212.63 g/mol |
| IUPAC name | 8-chloro-3,4-dihydro-2H-chromene-3-carboxylic acid |
| InChIKey | UDKQQZGONLQYLV-UHFFFAOYSA-N |
| SMILES | C1C(COC2=C1C=CC=C2Cl)C(=O)O |
Computed by PubChem (NCBI)