CAS 885278-46-6 is the registry number for 5-((3-Bromophenyl)methyl)-2H-1,2,3,4-tetrazole. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-[(3-bromophenyl)methyl]-2H-tetrazole (CAS 885278-46-6) is a chemical compound with the molecular formula C8H7BrN4 and a molecular weight of 239.07 g/mol. IUPAC name: 5-[(3-bromophenyl)methyl]-2H-tetrazole. InChIKey: UQRMUMBBOOAEJT-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN4 |
|---|---|
| Molecular weight | 239.07 g/mol |
| IUPAC name | 5-[(3-bromophenyl)methyl]-2H-tetrazole |
| InChIKey | UQRMUMBBOOAEJT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)CC2=NNN=N2 |
Computed by PubChem (NCBI)