Products 886496-75-9
CAS 886496-75-9 appears in our catalog under these names: 1–(Bromomethyl)–4–chloro–2–(trifluoromethyl)benzene, 1-(Bromomethyl)-4-chloro-2-(trifluoromethyl)benzene, 95%. Offered by: GLPBio, Fluorochem, Ambeed. Available pack sizes: 1g, 25g, 5g, 250mg.
1-(bromomethyl)-4-chloro-2-(trifluoromethyl)benzene (CAS 886496-75-9) is a chemical compound with the molecular formula C8H5BrClF3 and a molecular weight of 273.48 g/mol. IUPAC name: 1-(bromomethyl)-4-chloro-2-(trifluoromethyl)benzene. InChIKey: LFFCKOROEHFKQA-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClF3 |
|---|---|
| Molecular weight | 273.48 g/mol |
| IUPAC name | 1-(bromomethyl)-4-chloro-2-(trifluoromethyl)benzene |
| InChIKey | LFFCKOROEHFKQA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(F)(F)F)CBr |
Computed by PubChem (NCBI)