CAS 886593-45-9 appears in our catalog under these names: 4–(2–Hydroxy–2–propanyl)phenylboronic Acid, (4-(2-Hydroxypropan-2-yl)phenyl)boronic acid, 97%, 97%, (4-(2-Hydroxypropan-2-yl)phenyl)boronic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 25g, 100g.
[4-(2-hydroxypropan-2-yl)phenyl]boronic acid (CAS 886593-45-9) is a chemical compound with the molecular formula C9H13BO3 and a molecular weight of 180.01 g/mol. IUPAC name: [4-(2-hydroxypropan-2-yl)phenyl]boronic acid. InChIKey: DPIDNFWCDMXMDY-UHFFFAOYSA-N.
| Molecular formula | C9H13BO3 |
|---|---|
| Molecular weight | 180.01 g/mol |
| IUPAC name | [4-(2-hydroxypropan-2-yl)phenyl]boronic acid |
| InChIKey | DPIDNFWCDMXMDY-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(C)(C)O)(O)O |
Computed by PubChem (NCBI)