Products 886860-76-0
CAS 886860-76-0 is the registry number for Methyl 4-bromo-3-(difluoromethyl)benzoate, 95%. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 500mg.
Methyl 4-bromo-3-(difluoromethyl)benzoate (CAS 886860-76-0) is a chemical compound with the molecular formula C9H7BrF2O2 and a molecular weight of 265.05 g/mol. IUPAC name: methyl 4-bromo-3-(difluoromethyl)benzoate. InChIKey: DVIUYXNLLVZDJM-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O2 |
|---|---|
| Molecular weight | 265.05 g/mol |
| IUPAC name | methyl 4-bromo-3-(difluoromethyl)benzoate |
| InChIKey | DVIUYXNLLVZDJM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)Br)C(F)F |
Computed by PubChem (NCBI)