Products 887976-16-1
CAS 887976-16-1 appears in our catalog under these names: 6-(3-Methoxyphenyl)nicotinic acid, 97%, 6-(3-Methoxyphenyl)nicotinic acid, 95-<97%, 6–(3–Methoxyphenyl)nicotinic Acid, 6-(3-Methoxyphenyl)nicotinic Acid, >95%, >95%, 6-(3-Methoxyphenyl)nicotinic acid, >95%. Offered by: Combi-blocks, Hoffman Fine Chemicals, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g, 25g, 50g, 100g.
6-(3-methoxyphenyl)pyridine-3-carboxylic acid (CAS 887976-16-1) is a chemical compound with the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. IUPAC name: 6-(3-methoxyphenyl)pyridine-3-carboxylic acid. InChIKey: IMCPEUZGVSCIJS-UHFFFAOYSA-N.
| Molecular formula | C13H11NO3 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | 6-(3-methoxyphenyl)pyridine-3-carboxylic acid |
| InChIKey | IMCPEUZGVSCIJS-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=NC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)