Products 889593-85-5
CAS 889593-85-5 is the registry number for 3-(PYRROLIDINE-1-CARBONYL)PYRAZINE-2-CARBOXYLIC ACID, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-(pyrrolidine-1-carbonyl)pyrazine-2-carboxylic acid (CAS 889593-85-5) is a chemical compound with the molecular formula C10H11N3O3 and a molecular weight of 221.21 g/mol. IUPAC name: 3-(pyrrolidine-1-carbonyl)pyrazine-2-carboxylic acid. InChIKey: QVIWGLYNMBWZHN-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O3 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | 3-(pyrrolidine-1-carbonyl)pyrazine-2-carboxylic acid |
| InChIKey | QVIWGLYNMBWZHN-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C(=O)C2=NC=CN=C2C(=O)O |
Computed by PubChem (NCBI)