CAS 89-51-0 appears in our catalog under these names: Homophthalic acid, Homophthalic acid, Homophthalic acid, 99% , Homophthalic Acid, >99.0%(T), Homophthalic acid, 98%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Thermo Scientific (Acros). Available pack sizes: 2,5g, 250mg, 500mg, 100g, 25g, 50g, 250g, 5g.
2-(carboxymethyl)benzoic acid (CAS 89-51-0) is a chemical compound with the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. IUPAC name: 2-(carboxymethyl)benzoic acid. InChIKey: ZHQLTKAVLJKSKR-UHFFFAOYSA-N.
| Molecular formula | C9H8O4 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 2-(carboxymethyl)benzoic acid |
| InChIKey | ZHQLTKAVLJKSKR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)