Products 89366-33-6
CAS 89366-33-6 is the registry number for Indobufen Impurity 28. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
Methyl 5-carbonochloridoyl-2-hydroxybenzoate (CAS 89366-33-6) is a chemical compound with the molecular formula C9H7ClO4 and a molecular weight of 214.60 g/mol. IUPAC name: methyl 5-carbonochloridoyl-2-hydroxybenzoate. InChIKey: UDQJMKUYQSYZHV-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO4 |
|---|---|
| Molecular weight | 214.60 g/mol |
| IUPAC name | methyl 5-carbonochloridoyl-2-hydroxybenzoate |
| InChIKey | UDQJMKUYQSYZHV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)C(=O)Cl)O |
Computed by PubChem (NCBI)