CAS 893767-99-2 appears in our catalog under these names: Opicapone Impurity 8, Opicapone Impurity 6, 5-Chloro-4,6-dimethylisoxazolo[5,4-b]pyridin-3-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-4,6-dimethyl-[1,2]oxazolo[5,4-b]pyridin-3-amine (CAS 893767-99-2) is a chemical compound with the molecular formula C8H8ClN3O and a molecular weight of 197.62 g/mol. IUPAC name: 5-chloro-4,6-dimethyl-[1,2]oxazolo[5,4-b]pyridin-3-amine. InChIKey: XEYWCHKONZUDGB-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3O |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | 5-chloro-4,6-dimethyl-[1,2]oxazolo[5,4-b]pyridin-3-amine |
| InChIKey | XEYWCHKONZUDGB-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=NOC2=NC(=C1Cl)C)N |
Computed by PubChem (NCBI)