CAS 89642-21-7 is the registry number for 2-Iodo-4-nitrobenzylbromide, 95%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
1-(bromomethyl)-2-iodo-4-nitrobenzene (CAS 89642-21-7) is a chemical compound with the molecular formula C7H5BrINO2 and a molecular weight of 341.93 g/mol. IUPAC name: 1-(bromomethyl)-2-iodo-4-nitrobenzene. InChIKey: CSGDIBWHUNXCJM-UHFFFAOYSA-N.
| Molecular formula | C7H5BrINO2 |
|---|---|
| Molecular weight | 341.93 g/mol |
| IUPAC name | 1-(bromomethyl)-2-iodo-4-nitrobenzene |
| InChIKey | CSGDIBWHUNXCJM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])I)CBr |
Computed by PubChem (NCBI)