CAS 89891-83-8 appears in our catalog under these names: 2–Chloro–5–cyanobenzoic acid, 2-Chloro-5-cyanobenzoic acid, 2-Chloro-5-cyanobenzoic acid 95%, 2-Chloro-5-cyanobenzoic acid, 95%, 95%, 2-Chloro-5-cyanobenzoic acid, ≥95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 0,5g, 50mg, 100mg.
2-chloro-5-cyanobenzoic acid (CAS 89891-83-8) is a chemical compound with the molecular formula C8H4ClNO2 and a molecular weight of 181.57 g/mol. IUPAC name: 2-chloro-5-cyanobenzoic acid. InChIKey: OZNRJPYVSBAJLX-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO2 |
|---|---|
| Molecular weight | 181.57 g/mol |
| IUPAC name | 2-chloro-5-cyanobenzoic acid |
| InChIKey | OZNRJPYVSBAJLX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C#N)C(=O)O)Cl |
Computed by PubChem (NCBI)