Products 89894-53-1

CAS 89894-53-1 appears in our catalog under these names: 3,5-Dichloro-4-(hydroxymethyl)benzoic Acid, >95% (HPLC), 3,5-Dichloro-4-(hydroxymethyl)benzoic acid. Offered by: TRC, Dr. Ehrenstorfer. Available pack sizes: 100mg, 1g, 500mg, 10mg.

Structural formula: {0} (CAS {1})

3,5-dichloro-4-(hydroxymethyl)benzoic acid (CAS 89894-53-1) is a chemical compound with the molecular formula C8H6Cl2O3 and a molecular weight of 221.03 g/mol. IUPAC name: 3,5-dichloro-4-(hydroxymethyl)benzoic acid. InChIKey: WWKBFQWNMXRYAY-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6Cl2O3
Molecular weight221.03 g/mol
IUPAC name3,5-dichloro-4-(hydroxymethyl)benzoic acid
InChIKeyWWKBFQWNMXRYAY-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1Cl)CO)Cl)C(=O)O

Computed by PubChem (NCBI)