CAS 89894-53-1 appears in our catalog under these names: 3,5-Dichloro-4-(hydroxymethyl)benzoic Acid, >95% (HPLC), 3,5-Dichloro-4-(hydroxymethyl)benzoic acid. Offered by: TRC, Dr. Ehrenstorfer. Available pack sizes: 100mg, 1g, 500mg, 10mg.
3,5-dichloro-4-(hydroxymethyl)benzoic acid (CAS 89894-53-1) is a chemical compound with the molecular formula C8H6Cl2O3 and a molecular weight of 221.03 g/mol. IUPAC name: 3,5-dichloro-4-(hydroxymethyl)benzoic acid. InChIKey: WWKBFQWNMXRYAY-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O3 |
|---|---|
| Molecular weight | 221.03 g/mol |
| IUPAC name | 3,5-dichloro-4-(hydroxymethyl)benzoic acid |
| InChIKey | WWKBFQWNMXRYAY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)CO)Cl)C(=O)O |
Computed by PubChem (NCBI)