Products 899349-06-5
CAS 899349-06-5 is the registry number for 2-Amino-4-(3-chlorophenyl)-1,3-thiazole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-amino-4-(3-chlorophenyl)-1,3-thiazole-5-carboxylic acid (CAS 899349-06-5) is a chemical compound with the molecular formula C10H7ClN2O2S and a molecular weight of 254.69 g/mol. IUPAC name: 2-amino-4-(3-chlorophenyl)-1,3-thiazole-5-carboxylic acid. InChIKey: XFPVAXTVCHULMN-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2O2S |
|---|---|
| Molecular weight | 254.69 g/mol |
| IUPAC name | 2-amino-4-(3-chlorophenyl)-1,3-thiazole-5-carboxylic acid |
| InChIKey | XFPVAXTVCHULMN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=C(SC(=N2)N)C(=O)O |
Computed by PubChem (NCBI)