CAS 90767-49-0 is the registry number for 5-Chloro-2-hydroxy-N-(thiazol-2-yl)benzamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-2-hydroxy-N-(1,3-thiazol-2-yl)benzamide (CAS 90767-49-0) is a chemical compound with the molecular formula C10H7ClN2O2S and a molecular weight of 254.69 g/mol. IUPAC name: 5-chloro-2-hydroxy-N-(1,3-thiazol-2-yl)benzamide. InChIKey: OREAUWXYUKOWDY-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2O2S |
|---|---|
| Molecular weight | 254.69 g/mol |
| IUPAC name | 5-chloro-2-hydroxy-N-(1,3-thiazol-2-yl)benzamide |
| InChIKey | OREAUWXYUKOWDY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)NC2=NC=CS2)O |
Computed by PubChem (NCBI)