CAS 1206984-03-3 is the registry number for Methyl 2-(6-chloropyridin-3-yl)thiazole-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-(6-chloro-3-pyridinyl)-1,3-thiazole-4-carboxylate (CAS 1206984-03-3) is a chemical compound with the molecular formula C10H7ClN2O2S and a molecular weight of 254.69 g/mol. IUPAC name: methyl 2-(6-chloro-3-pyridinyl)-1,3-thiazole-4-carboxylate. InChIKey: CQVFOBBLZKYBRJ-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2O2S |
|---|---|
| Molecular weight | 254.69 g/mol |
| IUPAC name | methyl 2-(6-chloro-3-pyridinyl)-1,3-thiazole-4-carboxylate |
| InChIKey | CQVFOBBLZKYBRJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CSC(=N1)C2=CN=C(C=C2)Cl |
Computed by PubChem (NCBI)