Products 886361-44-0
CAS 886361-44-0 appears in our catalog under these names: 2-Amino-5-(2-chlorophenyl)-1,3-thiazole-4-carboxylic acid, 95%, 2-Amino-5-(2-chlorophenyl)thiazole-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2-amino-5-(2-chlorophenyl)-1,3-thiazole-4-carboxylic acid (CAS 886361-44-0) is a chemical compound with the molecular formula C10H7ClN2O2S and a molecular weight of 254.69 g/mol. IUPAC name: 2-amino-5-(2-chlorophenyl)-1,3-thiazole-4-carboxylic acid. InChIKey: YJVGYZXICGCQJN-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2O2S |
|---|---|
| Molecular weight | 254.69 g/mol |
| IUPAC name | 2-amino-5-(2-chlorophenyl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | YJVGYZXICGCQJN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=C(N=C(S2)N)C(=O)O)Cl |
Computed by PubChem (NCBI)