CAS 4771-32-8 appears in our catalog under these names: 4-(Chloromethyl)-2-(4-nitrophenyl)-1,3-thiazole, 95%, 4-(Chloromethyl)-2-(4-nitrophenyl)thiazole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
4-(chloromethyl)-2-(4-nitrophenyl)-1,3-thiazole (CAS 4771-32-8) is a chemical compound with the molecular formula C10H7ClN2O2S and a molecular weight of 254.69 g/mol. IUPAC name: 4-(chloromethyl)-2-(4-nitrophenyl)-1,3-thiazole. InChIKey: LFVAPAHRHVOVHQ-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2O2S |
|---|---|
| Molecular weight | 254.69 g/mol |
| IUPAC name | 4-(chloromethyl)-2-(4-nitrophenyl)-1,3-thiazole |
| InChIKey | LFVAPAHRHVOVHQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=CS2)CCl)[N+](=O)[O-] |
Computed by PubChem (NCBI)