CAS 165682-82-6 appears in our catalog under these names: 2-((4-Chlorophenyl)amino)-1,3-thiazole-4-carboxylic acid, 98%, 2-((4-Chlorophenyl)amino)-1,3-thiazole-4-carboxylic acid, 2-((4-Chlorophenyl)amino)thiazole-4-carboxylic acid, 98%, 98%, 2-(4-Chloro-phenylamino)-thiazole-4-carboxylic acid, 95%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 2g, 10g, 25g, 250mg, 1g.
2-(4-chloroanilino)-1,3-thiazole-4-carboxylic acid (CAS 165682-82-6) is a chemical compound with the molecular formula C10H7ClN2O2S and a molecular weight of 254.69 g/mol. IUPAC name: 2-(4-chloroanilino)-1,3-thiazole-4-carboxylic acid. InChIKey: CKPFGKWKFOXQJJ-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2O2S |
|---|---|
| Molecular weight | 254.69 g/mol |
| IUPAC name | 2-(4-chloroanilino)-1,3-thiazole-4-carboxylic acid |
| InChIKey | CKPFGKWKFOXQJJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC2=NC(=CS2)C(=O)O)Cl |
Computed by PubChem (NCBI)